C15H15F3N2S — CID 144838587
1-[2-benzylsulfanyl-3-(trifluoromethyl)phenyl]-1-methylhydrazine (PubChem CID 144838587) has the molecular formula C15H15F3N2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-[2-benzylsulfanyl-3-(trifluoromethyl)phenyl]-1-methylhydrazine.
| Compound Name | 1-[2-benzylsulfanyl-3-(trifluoromethyl)phenyl]-1-methylhydrazine |
|---|---|
| PubChem CID | 144838587 |
| Molecular Formula | C15H15F3N2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-[2-benzylsulfanyl-3-(trifluoromethyl)phenyl]-1-methylhydrazine |
| SMILES | CN(N)c1cccc(C(F)(F)F)c1SCc1ccccc1 |
| InChI | InChI=1S/C15H15F3N2S/c1-20(19)13-9-5-8-12(15(16,17)18)14(13)21-10-11-6-3-2-4-7-11/h2-9H,10,19H2,1H3 |
| InChIKey | DPPAPNXHHQGCEG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|