About [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate
[(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate (PubChem CID 144839201) has the molecular formula C21H22N2O5
and a molecular weight of 382.42 g/mol. Its IUPAC name is [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate.
Molecular Properties
| Compound Name | [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate |
| PubChem CID | 144839201 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)O/N=C(/C)C(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-4-15(5-2)21(25)28-22-14(3)20(24)18-8-6-16(7-9-18)17-10-12-19(13-11-17)23(26)27/h6-13,15H,4-5H2,1-3H3/b22-14- |
| InChIKey | WEDRRSOSQDBNHE-HMAPJEAMSA-N |
| XLogP | 4.80 |
| TPSA | 98.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate?
The IUPAC name of [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate (CID 144839201) is [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate.
What is the SMILES notation for [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate?
The canonical SMILES for [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate is CCC(CC)C(=O)O/N=C(/C)C(=O)c1ccc(-c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate?
The InChIKey is WEDRRSOSQDBNHE-HMAPJEAMSA-N. The full InChI is InChI=1S/C21H22N2O5/c1-4-15(5-2)21(25)28-22-14(3)20(24)18-8-6-16(7-9-18)17-10-12-19(13-11-17)23(26)27/h6-13,15H,4-5H2,1-3H3/b22-14-.
What are the key properties of [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate?
[(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate has a molecular weight of 382.42 g/mol, XLogP of 4.80, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[1-[4-(4-nitrophenyl)phenyl]-1-oxopropan-2-ylidene]amino] 2-ethylbutanoate is sourced from PubChem (CID 144839201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).