C27H36ClN5O4S — CID 144839567
3-[[7-chloro-4-(3-methylsulfonylpropoxy)quinazolin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one;ethane;propane (PubChem CID 144839567) has the molecular formula C27H36ClN5O4S and a molecular weight of 562.14 g/mol. Its IUPAC name is 3-[[7-chloro-4-(3-methylsulfonylpropoxy)quinazolin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one;ethane;propane.
| Compound Name | 3-[[7-chloro-4-(3-methylsulfonylpropoxy)quinazolin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one;ethane;propane |
|---|---|
| PubChem CID | 144839567 |
| Molecular Formula | C27H36ClN5O4S |
| Molecular Weight | 562.14 g/mol |
| Exact Mass | 561.22 |
| IUPAC Name | 3-[[7-chloro-4-(3-methylsulfonylpropoxy)quinazolin-2-yl]methyl]-1-cyclopropylimidazo[4,5-c]pyridin-2-one;ethane;propane |
| SMILES | CC.CCC.CS(=O)(=O)CCCOc1nc(Cn2c(=O)n(C3CC3)c3ccncc32)nc2cc(Cl)ccc12 |
| InChI | InChI=1S/C22H22ClN5O4S.C3H8.C2H6/c1-33(30,31)10-2-9-32-21-16-6-3-14(23)11-17(16)25-20(26-21)13-27-19-12-24-8-7-18(19)28(22(27)29)15-4-5-15;1-3-2;1-2/h3,6-8,11-12,15H,2,4-5,9-10,13H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | QYYDJJPUDSLOCH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 108.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.14 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|