About pyridin-2-yl 2-methylidenepent-4-enoate
pyridin-2-yl 2-methylidenepent-4-enoate (PubChem CID 144839722) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is pyridin-2-yl 2-methylidenepent-4-enoate.
Molecular Properties
| Compound Name | pyridin-2-yl 2-methylidenepent-4-enoate |
| PubChem CID | 144839722 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | pyridin-2-yl 2-methylidenepent-4-enoate |
| SMILES | C=CCC(=C)C(=O)Oc1ccccn1 |
| InChI | InChI=1S/C11H11NO2/c1-3-6-9(2)11(13)14-10-7-4-5-8-12-10/h3-5,7-8H,1-2,6H2 |
| InChIKey | SRUPMXWGALFQCO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze pyridin-2-yl 2-methylidenepent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridin-2-yl 2-methylidenepent-4-enoate?
The IUPAC name of pyridin-2-yl 2-methylidenepent-4-enoate (CID 144839722) is pyridin-2-yl 2-methylidenepent-4-enoate.
What is the SMILES notation for pyridin-2-yl 2-methylidenepent-4-enoate?
The canonical SMILES for pyridin-2-yl 2-methylidenepent-4-enoate is C=CCC(=C)C(=O)Oc1ccccn1.
What is the InChIKey of pyridin-2-yl 2-methylidenepent-4-enoate?
The InChIKey is SRUPMXWGALFQCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-3-6-9(2)11(13)14-10-7-4-5-8-12-10/h3-5,7-8H,1-2,6H2.
What are the key properties of pyridin-2-yl 2-methylidenepent-4-enoate?
pyridin-2-yl 2-methylidenepent-4-enoate has a molecular weight of 189.21 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridin-2-yl 2-methylidenepent-4-enoate is sourced from PubChem (CID 144839722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).