About ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide
ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide (PubChem CID 144840601) has the molecular formula C9H19F3N2O
and a molecular weight of 228.26 g/mol. Its IUPAC name is ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide.
Molecular Properties
| Compound Name | ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide |
| PubChem CID | 144840601 |
| Molecular Formula | C9H19F3N2O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide |
| SMILES | CC.CNCC(=O)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O.C2H6/c1-11-5-6(13)12(2)4-3-7(8,9)10;1-2/h11H,3-5H2,1-2H3;1-2H3 |
| InChIKey | PQOCVFHKWMXBIO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide?
The IUPAC name of ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide (CID 144840601) is ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide.
What is the SMILES notation for ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide?
The canonical SMILES for ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide is CC.CNCC(=O)N(C)CCC(F)(F)F.
What is the InChIKey of ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide?
The InChIKey is PQOCVFHKWMXBIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13F3N2O.C2H6/c1-11-5-6(13)12(2)4-3-7(8,9)10;1-2/h11H,3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide?
ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide has a molecular weight of 228.26 g/mol, XLogP of 1.64, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-2-(methylamino)-N-(3,3,3-trifluoropropyl)acetamide is sourced from PubChem (CID 144840601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).