About N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine
N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine (PubChem CID 144840717) has the molecular formula C8H7N3O
and a molecular weight of 161.16 g/mol. Its IUPAC name is N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine.
Molecular Properties
| Compound Name | N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine |
| PubChem CID | 144840717 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine |
| SMILES | ON=Cc1ccn2nccc2c1 |
| InChI | InChI=1S/C8H7N3O/c12-10-6-7-2-4-11-8(5-7)1-3-9-11/h1-6,12H |
| InChIKey | BYYVWJMRIKZGME-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine?
The IUPAC name of N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine (CID 144840717) is N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine.
What is the SMILES notation for N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine?
The canonical SMILES for N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine is ON=Cc1ccn2nccc2c1.
What is the InChIKey of N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine?
The InChIKey is BYYVWJMRIKZGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O/c12-10-6-7-2-4-11-8(5-7)1-3-9-11/h1-6,12H.
What are the key properties of N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine?
N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine has a molecular weight of 161.16 g/mol, XLogP of 1.14, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(pyrazolo[1,5-a]pyridin-5-ylmethylidene)hydroxylamine is sourced from PubChem (CID 144840717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).