About 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide
2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide (PubChem CID 144841012) has the molecular formula C15H22N2OS
and a molecular weight of 278.42 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide |
| PubChem CID | 144841012 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide |
| SMILES | CNS(=O)C(C)(C)C.N#Cc1cccc2c1CCC2 |
| InChI | InChI=1S/C10H9N.C5H13NOS/c11-7-9-5-1-3-8-4-2-6-10(8)9;1-5(2,3)8(7)6-4/h1,3,5H,2,4,6H2;6H,1-4H3 |
| InChIKey | MYAOIONYYDOZSD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide?
The IUPAC name of 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide (CID 144841012) is 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide.
What is the SMILES notation for 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide?
The canonical SMILES for 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide is CNS(=O)C(C)(C)C.N#Cc1cccc2c1CCC2.
What is the InChIKey of 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide?
The InChIKey is MYAOIONYYDOZSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N.C5H13NOS/c11-7-9-5-1-3-8-4-2-6-10(8)9;1-5(2,3)8(7)6-4/h1,3,5H,2,4,6H2;6H,1-4H3.
What are the key properties of 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide?
2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide has a molecular weight of 278.42 g/mol, XLogP of 2.71, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-indene-4-carbonitrile;N,2-dimethylpropane-2-sulfinamide is sourced from PubChem (CID 144841012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).