C9H20N2O2 — CID 144841016
ethane;4-(hydroxymethyl)piperidine-1-carboxamide (PubChem CID 144841016) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is ethane;4-(hydroxymethyl)piperidine-1-carboxamide.
| Compound Name | ethane;4-(hydroxymethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 144841016 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | ethane;4-(hydroxymethyl)piperidine-1-carboxamide |
| SMILES | CC.NC(=O)N1CCC(CO)CC1 |
| InChI | InChI=1S/C7H14N2O2.C2H6/c8-7(11)9-3-1-6(5-10)2-4-9;1-2/h6,10H,1-5H2,(H2,8,11);1-2H3 |
| InChIKey | HNHVEYSEBXLSDJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |