C18H25N5O5 — CID 144841851
2-[4-[(2Z)-2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]-N-methylanilino]ethyl formate;ethane (PubChem CID 144841851) has the molecular formula C18H25N5O5 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[4-[(2Z)-2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]-N-methylanilino]ethyl formate;ethane.
| Compound Name | 2-[4-[(2Z)-2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]-N-methylanilino]ethyl formate;ethane |
|---|---|
| PubChem CID | 144841851 |
| Molecular Formula | C18H25N5O5 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 2-[4-[(2Z)-2-[1-cyano-2-(ethoxycarbonylamino)-2-oxoethylidene]hydrazinyl]-N-methylanilino]ethyl formate;ethane |
| SMILES | CC.CCOC(=O)NC(=O)/C(C#N)=N\Nc1ccc(N(C)CCOC=O)cc1 |
| InChI | InChI=1S/C16H19N5O5.C2H6/c1-3-26-16(24)18-15(23)14(10-17)20-19-12-4-6-13(7-5-12)21(2)8-9-25-11-22;1-2/h4-7,11,19H,3,8-9H2,1-2H3,(H,18,23,24);1-2H3/b20-14-; |
| InChIKey | NLKLMUUEFBKZMN-VSOKSMTPSA-N |
| XLogP | 1.89 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|