C9H12F6O4 — CID 144841967
2-methoxyethyl 3,3,3-trifluoropropanoate;3,3,3-trifluoropropanal (PubChem CID 144841967) has the molecular formula C9H12F6O4 and a molecular weight of 298.18 g/mol. Its IUPAC name is 2-methoxyethyl 3,3,3-trifluoropropanoate;3,3,3-trifluoropropanal.
| Compound Name | 2-methoxyethyl 3,3,3-trifluoropropanoate;3,3,3-trifluoropropanal |
|---|---|
| PubChem CID | 144841967 |
| Molecular Formula | C9H12F6O4 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | 2-methoxyethyl 3,3,3-trifluoropropanoate;3,3,3-trifluoropropanal |
| SMILES | COCCOC(=O)CC(F)(F)F.O=CCC(F)(F)F |
| InChI | InChI=1S/C6H9F3O3.C3H3F3O/c1-11-2-3-12-5(10)4-6(7,8)9;4-3(5,6)1-2-7/h2-4H2,1H3;2H,1H2 |
| InChIKey | LWDVVXJGWBWGHQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|