About (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene
(6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene (PubChem CID 144842164) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene |
| PubChem CID | 144842164 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene |
| SMILES | C=CC1C=CC=C(C)[C@@H]1C=C |
| InChI | InChI=1S/C11H14/c1-4-10-8-6-7-9(3)11(10)5-2/h4-8,10-11H,1-2H2,3H3/t10?,11-/m0/s1 |
| InChIKey | ZBTIIKYPGVPCAY-DTIOYNMSSA-N |
| XLogP | 3.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene?
The IUPAC name of (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene (CID 144842164) is (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene.
What is the SMILES notation for (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene?
The canonical SMILES for (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene is C=CC1C=CC=C(C)[C@@H]1C=C.
What is the InChIKey of (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene?
The InChIKey is ZBTIIKYPGVPCAY-DTIOYNMSSA-N. The full InChI is InChI=1S/C11H14/c1-4-10-8-6-7-9(3)11(10)5-2/h4-8,10-11H,1-2H2,3H3/t10?,11-/m0/s1.
What are the key properties of (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene?
(6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene has a molecular weight of 146.23 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-5,6-bis(ethenyl)-1-methylcyclohexa-1,3-diene is sourced from PubChem (CID 144842164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).