About ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane
ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane (PubChem CID 144842549) has the molecular formula C13H24N2
and a molecular weight of 208.35 g/mol. Its IUPAC name is ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane.
Molecular Properties
| Compound Name | ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane |
| PubChem CID | 144842549 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane |
| SMILES | C=C/C=N\c1[nH]ccc1C.CC.CCC |
| InChI | InChI=1S/C8H10N2.C3H8.C2H6/c1-3-5-9-8-7(2)4-6-10-8;1-3-2;1-2/h3-6,10H,1H2,2H3;3H2,1-2H3;1-2H3/b9-5-;; |
| InChIKey | LPXPTGIRVGNCIZ-XDYVNXDCSA-N |
| XLogP | 4.65 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane?
The IUPAC name of ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane (CID 144842549) is ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane.
What is the SMILES notation for ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane?
The canonical SMILES for ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane is C=C/C=N\c1[nH]ccc1C.CC.CCC.
What is the InChIKey of ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane?
The InChIKey is LPXPTGIRVGNCIZ-XDYVNXDCSA-N. The full InChI is InChI=1S/C8H10N2.C3H8.C2H6/c1-3-5-9-8-7(2)4-6-10-8;1-3-2;1-2/h3-6,10H,1H2,2H3;3H2,1-2H3;1-2H3/b9-5-;;.
What are the key properties of ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane?
ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane has a molecular weight of 208.35 g/mol, XLogP of 4.65, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(Z)-N-(3-methyl-1H-pyrrol-2-yl)prop-2-en-1-imine;propane is sourced from PubChem (CID 144842549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).