C25H48O4 — CID 144842737
2-cyclopropyl-2,4-dimethyl-1,3-dioxolane;ethane;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-1,3-dioxolane (PubChem CID 144842737) has the molecular formula C25H48O4 and a molecular weight of 412.66 g/mol. Its IUPAC name is 2-cyclopropyl-2,4-dimethyl-1,3-dioxolane;ethane;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-1,3-dioxolane.
| Compound Name | 2-cyclopropyl-2,4-dimethyl-1,3-dioxolane;ethane;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-1,3-dioxolane |
|---|---|
| PubChem CID | 144842737 |
| Molecular Formula | C25H48O4 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.36 |
| IUPAC Name | 2-cyclopropyl-2,4-dimethyl-1,3-dioxolane;ethane;2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-methyl-1,3-dioxolane |
| SMILES | C=C/C=C(\C=C/C)C1(C)OCCO1.CC.CC.CC.CC1COC(C)(C2CC2)O1 |
| InChI | InChI=1S/C11H16O2.C8H14O2.3C2H6/c1-4-6-10(7-5-2)11(3)12-8-9-13-11;1-6-5-9-8(2,10-6)7-3-4-7;3*1-2/h4-7H,1,8-9H2,2-3H3;6-7H,3-5H2,1-2H3;3*1-2H3/b7-5-,10-6+;;;; |
| InChIKey | YMFFALGWALXONY-JLPFQQQXSA-N |
| XLogP | 7.06 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|