C8H13FO2 — CID 144842951
(2S,3R,4R)-2-ethenyl-4-fluoro-2,5-dimethyloxolan-3-ol (PubChem CID 144842951) has the molecular formula C8H13FO2 and a molecular weight of 160.19 g/mol. Its IUPAC name is (2S,3R,4R)-2-ethenyl-4-fluoro-2,5-dimethyloxolan-3-ol.
| Compound Name | (2S,3R,4R)-2-ethenyl-4-fluoro-2,5-dimethyloxolan-3-ol |
|---|---|
| PubChem CID | 144842951 |
| Molecular Formula | C8H13FO2 |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (2S,3R,4R)-2-ethenyl-4-fluoro-2,5-dimethyloxolan-3-ol |
| SMILES | C=C[C@]1(C)OC(C)[C@H](F)[C@@H]1O |
| InChI | InChI=1S/C8H13FO2/c1-4-8(3)7(10)6(9)5(2)11-8/h4-7,10H,1H2,2-3H3/t5?,6-,7-,8-/m0/s1 |
| InChIKey | FWOZGAKYDSCGDI-DWQAGKKUSA-N |
| XLogP | 1.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|