C23H24ClN3O3 — CID 144844732
3-[3-(2-chloroacetyl)-1-(4-cyanophenyl)-2,5-dimethylpyrrolo[3,2-b]pyridin-6-yl]propanoic acid;ethane (PubChem CID 144844732) has the molecular formula C23H24ClN3O3 and a molecular weight of 425.92 g/mol. Its IUPAC name is 3-[3-(2-chloroacetyl)-1-(4-cyanophenyl)-2,5-dimethylpyrrolo[3,2-b]pyridin-6-yl]propanoic acid;ethane.
| Compound Name | 3-[3-(2-chloroacetyl)-1-(4-cyanophenyl)-2,5-dimethylpyrrolo[3,2-b]pyridin-6-yl]propanoic acid;ethane |
|---|---|
| PubChem CID | 144844732 |
| Molecular Formula | C23H24ClN3O3 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-[3-(2-chloroacetyl)-1-(4-cyanophenyl)-2,5-dimethylpyrrolo[3,2-b]pyridin-6-yl]propanoic acid;ethane |
| SMILES | CC.Cc1nc2c(C(=O)CCl)c(C)n(-c3ccc(C#N)cc3)c2cc1CCC(=O)O |
| InChI | InChI=1S/C21H18ClN3O3.C2H6/c1-12-15(5-8-19(27)28)9-17-21(24-12)20(18(26)10-22)13(2)25(17)16-6-3-14(11-23)4-7-16;1-2/h3-4,6-7,9H,5,8,10H2,1-2H3,(H,27,28);1-2H3 |
| InChIKey | DDXZORYTQCOQGW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|