About (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate
(12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate (PubChem CID 144844944) has the molecular formula C17H28O5
and a molecular weight of 312.41 g/mol. Its IUPAC name is (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate.
Molecular Properties
| Compound Name | (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate |
| PubChem CID | 144844944 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate |
| SMILES | CCCOC(CCC=CCCC=CCCC=O)OOC(C)=O |
| InChI | InChI=1S/C17H28O5/c1-3-15-20-17(22-21-16(2)19)13-11-9-7-5-4-6-8-10-12-14-18/h6-9,14,17H,3-5,10-13,15H2,1-2H3 |
| InChIKey | SLCLLFJYJIEPFK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate?
The IUPAC name of (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate (CID 144844944) is (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate.
What is the SMILES notation for (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate?
The canonical SMILES for (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate is CCCOC(CCC=CCCC=CCCC=O)OOC(C)=O.
What is the InChIKey of (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate?
The InChIKey is SLCLLFJYJIEPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O5/c1-3-15-20-17(22-21-16(2)19)13-11-9-7-5-4-6-8-10-12-14-18/h6-9,14,17H,3-5,10-13,15H2,1-2H3.
What are the key properties of (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate?
(12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate has a molecular weight of 312.41 g/mol, XLogP of 3.89, 14 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (12-oxo-1-propoxydodeca-4,8-dienyl) ethaneperoxoate is sourced from PubChem (CID 144844944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).