C13H13ClFN5O — CID 144845127
5-amino-2-(3-chloro-4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide (PubChem CID 144845127) has the molecular formula C13H13ClFN5O and a molecular weight of 309.73 g/mol. Its IUPAC name is 5-amino-2-(3-chloro-4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide.
| Compound Name | 5-amino-2-(3-chloro-4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 144845127 |
| Molecular Formula | C13H13ClFN5O |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-amino-2-(3-chloro-4-fluorophenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3-carboxamide |
| SMILES | NC(=O)c1c(-c2ccc(F)c(Cl)c2)nn2c1CN(N)CC2 |
| InChI | InChI=1S/C13H13ClFN5O/c14-8-5-7(1-2-9(8)15)12-11(13(16)21)10-6-19(17)3-4-20(10)18-12/h1-2,5H,3-4,6,17H2,(H2,16,21) |
| InChIKey | GUUHZRAPDBZNBP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|