C20H36ClN — CID 144845854
(3E,5E)-5-chloro-N-(4-methylhexyl)-3-propan-2-yl-N-propylhepta-1,3,5-trien-4-amine (PubChem CID 144845854) has the molecular formula C20H36ClN and a molecular weight of 325.97 g/mol. Its IUPAC name is (3E,5E)-5-chloro-N-(4-methylhexyl)-3-propan-2-yl-N-propylhepta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-5-chloro-N-(4-methylhexyl)-3-propan-2-yl-N-propylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 144845854 |
| Molecular Formula | C20H36ClN |
| Molecular Weight | 325.97 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | (3E,5E)-5-chloro-N-(4-methylhexyl)-3-propan-2-yl-N-propylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C(=C(C(\Cl)=C/C)/N(CCC)CCCC(C)CC)C(C)C |
| InChI | InChI=1S/C20H36ClN/c1-8-14-22(15-12-13-17(7)9-2)20(19(21)11-4)18(10-3)16(5)6/h10-11,16-17H,3,8-9,12-15H2,1-2,4-7H3/b19-11+,20-18- |
| InChIKey | FOVFKZQCZWMFBP-IVUIJMHVSA-N |
| XLogP | 6.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.97 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|