C19H32F2N2O3S — CID 144846519
1-[4-[3-(1,1-difluoroethyl)cyclohexyl]sulfonyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone (PubChem CID 144846519) has the molecular formula C19H32F2N2O3S and a molecular weight of 406.54 g/mol. Its IUPAC name is 1-[4-[3-(1,1-difluoroethyl)cyclohexyl]sulfonyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[4-[3-(1,1-difluoroethyl)cyclohexyl]sulfonyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 144846519 |
| Molecular Formula | C19H32F2N2O3S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | 1-[4-[3-(1,1-difluoroethyl)cyclohexyl]sulfonyl-2-methyl-2,3,4a,5,6,7,8,8a-octahydroquinoxalin-1-yl]ethanone |
| SMILES | CC(=O)N1C(C)CN(S(=O)(=O)C2CCCC(C(C)(F)F)C2)C2CCCCC21 |
| InChI | InChI=1S/C19H32F2N2O3S/c1-13-12-22(17-9-4-5-10-18(17)23(13)14(2)24)27(25,26)16-8-6-7-15(11-16)19(3,20)21/h13,15-18H,4-12H2,1-3H3 |
| InChIKey | VECLMZNOYSALMT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |