C23H25F2N3O3S — CID 144846757
(3,3-difluorocyclobutyl) 4-acetyl-3-methyl-7-[4-(methylsulfanylamino)phenyl]-2,3-dihydroquinoxaline-1-carboxylate (PubChem CID 144846757) has the molecular formula C23H25F2N3O3S and a molecular weight of 461.53 g/mol. Its IUPAC name is (3,3-difluorocyclobutyl) 4-acetyl-3-methyl-7-[4-(methylsulfanylamino)phenyl]-2,3-dihydroquinoxaline-1-carboxylate.
| Compound Name | (3,3-difluorocyclobutyl) 4-acetyl-3-methyl-7-[4-(methylsulfanylamino)phenyl]-2,3-dihydroquinoxaline-1-carboxylate |
|---|---|
| PubChem CID | 144846757 |
| Molecular Formula | C23H25F2N3O3S |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | (3,3-difluorocyclobutyl) 4-acetyl-3-methyl-7-[4-(methylsulfanylamino)phenyl]-2,3-dihydroquinoxaline-1-carboxylate |
| SMILES | CSNc1ccc(-c2ccc3c(c2)N(C(=O)OC2CC(F)(F)C2)CC(C)N3C(C)=O)cc1 |
| InChI | InChI=1S/C23H25F2N3O3S/c1-14-13-27(22(30)31-19-11-23(24,25)12-19)21-10-17(6-9-20(21)28(14)15(2)29)16-4-7-18(8-5-16)26-32-3/h4-10,14,19,26H,11-13H2,1-3H3 |
| InChIKey | WLQBAJVFIJOBRB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|