C12H14BrF3N2O — CID 144846783
7-bromo-3,4-dimethyl-2,3-dihydro-1H-quinoxaline;2,2,2-trifluoroacetaldehyde (PubChem CID 144846783) has the molecular formula C12H14BrF3N2O and a molecular weight of 339.16 g/mol. Its IUPAC name is 7-bromo-3,4-dimethyl-2,3-dihydro-1H-quinoxaline;2,2,2-trifluoroacetaldehyde.
| Compound Name | 7-bromo-3,4-dimethyl-2,3-dihydro-1H-quinoxaline;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 144846783 |
| Molecular Formula | C12H14BrF3N2O |
| Molecular Weight | 339.16 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 7-bromo-3,4-dimethyl-2,3-dihydro-1H-quinoxaline;2,2,2-trifluoroacetaldehyde |
| SMILES | CC1CNc2cc(Br)ccc2N1C.O=CC(F)(F)F |
| InChI | InChI=1S/C10H13BrN2.C2HF3O/c1-7-6-12-9-5-8(11)3-4-10(9)13(7)2;3-2(4,5)1-6/h3-5,7,12H,6H2,1-2H3;1H |
| InChIKey | RYKIAUAJEWTOIT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.16 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|