About 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane
8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane (PubChem CID 144847132) has the molecular formula C15H18BrN3O
and a molecular weight of 336.23 g/mol. Its IUPAC name is 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane.
Molecular Properties
| Compound Name | 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane |
| PubChem CID | 144847132 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane |
| SMILES | CCCC.Cn1c(=O)[nH]c2c3cc(Br)ccc3ncc21 |
| InChI | InChI=1S/C11H8BrN3O.C4H10/c1-15-9-5-13-8-3-2-6(12)4-7(8)10(9)14-11(15)16;1-3-4-2/h2-5H,1H3,(H,14,16);3-4H2,1-2H3 |
| InChIKey | TVHJMRFQEXVPCY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane?
The IUPAC name of 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane (CID 144847132) is 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane.
What is the SMILES notation for 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane?
The canonical SMILES for 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane is CCCC.Cn1c(=O)[nH]c2c3cc(Br)ccc3ncc21.
What is the InChIKey of 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane?
The InChIKey is TVHJMRFQEXVPCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrN3O.C4H10/c1-15-9-5-13-8-3-2-6(12)4-7(8)10(9)14-11(15)16;1-3-4-2/h2-5H,1H3,(H,14,16);3-4H2,1-2H3.
What are the key properties of 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane?
8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane has a molecular weight of 336.23 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-3-methyl-1H-imidazo[4,5-c]quinolin-2-one;butane is sourced from PubChem (CID 144847132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).