C18H31BN4O2 — CID 144847151
ethane;2-(1-methyltriazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 144847151) has the molecular formula C18H31BN4O2 and a molecular weight of 346.28 g/mol. Its IUPAC name is ethane;2-(1-methyltriazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | ethane;2-(1-methyltriazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 144847151 |
| Molecular Formula | C18H31BN4O2 |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | ethane;2-(1-methyltriazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC.CC.Cn1cc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cn2)nn1 |
| InChI | InChI=1S/C14H19BN4O2.2C2H6/c1-13(2)14(3,4)21-15(20-13)10-6-7-11(16-8-10)12-9-19(5)18-17-12;2*1-2/h6-9H,1-5H3;2*1-2H3 |
| InChIKey | VWBJEYTZKZRQEN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|