C25H29N7O2 — CID 144847191
8-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-3-pyridinyl]-1-(4-hydroxycyclohexyl)-3-methylimidazo[4,5-c]quinolin-2-one (PubChem CID 144847191) has the molecular formula C25H29N7O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 8-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-3-pyridinyl]-1-(4-hydroxycyclohexyl)-3-methylimidazo[4,5-c]quinolin-2-one.
| Compound Name | 8-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-3-pyridinyl]-1-(4-hydroxycyclohexyl)-3-methylimidazo[4,5-c]quinolin-2-one |
|---|---|
| PubChem CID | 144847191 |
| Molecular Formula | C25H29N7O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 8-[6-[(Z)-1-amino-2-[amino(methyl)amino]ethenyl]-3-pyridinyl]-1-(4-hydroxycyclohexyl)-3-methylimidazo[4,5-c]quinolin-2-one |
| SMILES | CN(N)/C=C(\N)c1ccc(-c2ccc3ncc4c(c3c2)n(C2CCC(O)CC2)c(=O)n4C)cn1 |
| InChI | InChI=1S/C25H29N7O2/c1-30(27)14-20(26)22-10-4-16(12-28-22)15-3-9-21-19(11-15)24-23(13-29-21)31(2)25(34)32(24)17-5-7-18(33)8-6-17/h3-4,9-14,17-18,33H,5-8,26-27H2,1-2H3/b20-14- |
| InChIKey | SHNMHYPJOAZCMG-ZHZULCJRSA-N |
| XLogP | 2.49 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|