C31H37N7O2S — CID 144847675
[benzyl-[3-(dimethylamino)propyl]amino]-[(7S)-4-[(6-methoxy-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanol (PubChem CID 144847675) has the molecular formula C31H37N7O2S and a molecular weight of 571.75 g/mol. Its IUPAC name is [benzyl-[3-(dimethylamino)propyl]amino]-[(7S)-4-[(6-methoxy-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanol.
| Compound Name | [benzyl-[3-(dimethylamino)propyl]amino]-[(7S)-4-[(6-methoxy-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanol |
|---|---|
| PubChem CID | 144847675 |
| Molecular Formula | C31H37N7O2S |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.27 |
| IUPAC Name | [benzyl-[3-(dimethylamino)propyl]amino]-[(7S)-4-[(6-methoxy-1H-indazol-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]methanol |
| SMILES | COc1cc2[nH]ncc2cc1Nc1ncnc2sc3c(c12)CC[C@H](C(O)N(CCCN(C)C)Cc1ccccc1)C3 |
| InChI | InChI=1S/C31H37N7O2S/c1-37(2)12-7-13-38(18-20-8-5-4-6-9-20)31(39)21-10-11-23-27(15-21)41-30-28(23)29(32-19-33-30)35-25-14-22-17-34-36-24(22)16-26(25)40-3/h4-6,8-9,14,16-17,19,21,31,39H,7,10-13,15,18H2,1-3H3,(H,34,36)(H,32,33,35)/t21-,31?/m0/s1 |
| InChIKey | PDDFFYXBOJALIE-FEAGIOCNSA-N |
| XLogP | 5.20 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|