C20H30N2 — CID 144847856
ethane;3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3,4-dihydropyrazole (PubChem CID 144847856) has the molecular formula C20H30N2 and a molecular weight of 298.47 g/mol. Its IUPAC name is ethane;3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3,4-dihydropyrazole.
| Compound Name | ethane;3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3,4-dihydropyrazole |
|---|---|
| PubChem CID | 144847856 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | ethane;3-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]-3,4-dihydropyrazole |
| SMILES | C=C/C=C(\C=C/C)C1CC=NN1C(/C=C\C)=C/C=C\C.CC |
| InChI | InChI=1S/C18H24N2.C2H6/c1-5-9-13-17(12-8-4)20-18(14-15-19-20)16(10-6-2)11-7-3;1-2/h5-13,15,18H,2,14H2,1,3-4H3;1-2H3/b9-5-,11-7-,12-8-,16-10+,17-13+; |
| InChIKey | UDXXKZIRSKUNPV-ODDQSVOZSA-N |
| XLogP | 5.80 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|