C7H18N2O — CID 144847979
1-(dimethylamino)ethenol;N,N-dimethylmethanamine (PubChem CID 144847979) has the molecular formula C7H18N2O and a molecular weight of 146.23 g/mol. Its IUPAC name is 1-(dimethylamino)ethenol;N,N-dimethylmethanamine.
| Compound Name | 1-(dimethylamino)ethenol;N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 144847979 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 1-(dimethylamino)ethenol;N,N-dimethylmethanamine |
| SMILES | C=C(O)N(C)C.CN(C)C |
| InChI | InChI=1S/C4H9NO.C3H9N/c1-4(6)5(2)3;1-4(2)3/h6H,1H2,2-3H3;1-3H3 |
| InChIKey | ZDJUGFMVXSGJRH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|