About 1-(dimethylamino)ethenol;N,N-dimethylmethanamine
1-(dimethylamino)ethenol;N,N-dimethylmethanamine (PubChem CID 144847979) has the molecular formula C7H18N2O
and a molecular weight of 146.23 g/mol. Its IUPAC name is 1-(dimethylamino)ethenol;N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(dimethylamino)ethenol;N,N-dimethylmethanamine |
| PubChem CID | 144847979 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | 1-(dimethylamino)ethenol;N,N-dimethylmethanamine |
| SMILES | C=C(O)N(C)C.CN(C)C |
| InChI | InChI=1S/C4H9NO.C3H9N/c1-4(6)5(2)3;1-4(2)3/h6H,1H2,2-3H3;1-3H3 |
| InChIKey | ZDJUGFMVXSGJRH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylamino)ethenol;N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylamino)ethenol;N,N-dimethylmethanamine?
The IUPAC name of 1-(dimethylamino)ethenol;N,N-dimethylmethanamine (CID 144847979) is 1-(dimethylamino)ethenol;N,N-dimethylmethanamine.
What is the SMILES notation for 1-(dimethylamino)ethenol;N,N-dimethylmethanamine?
The canonical SMILES for 1-(dimethylamino)ethenol;N,N-dimethylmethanamine is C=C(O)N(C)C.CN(C)C.
What is the InChIKey of 1-(dimethylamino)ethenol;N,N-dimethylmethanamine?
The InChIKey is ZDJUGFMVXSGJRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C3H9N/c1-4(6)5(2)3;1-4(2)3/h6H,1H2,2-3H3;1-3H3.
What are the key properties of 1-(dimethylamino)ethenol;N,N-dimethylmethanamine?
1-(dimethylamino)ethenol;N,N-dimethylmethanamine has a molecular weight of 146.23 g/mol, XLogP of 0.75, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylamino)ethenol;N,N-dimethylmethanamine is sourced from PubChem (CID 144847979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).