About (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene
(Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene (PubChem CID 144848279) has the molecular formula C19H27NO2S
and a molecular weight of 333.50 g/mol. Its IUPAC name is (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene.
Molecular Properties
| Compound Name | (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene |
| PubChem CID | 144848279 |
| Molecular Formula | C19H27NO2S |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene |
| SMILES | C/C=C(\C(C)c1cc2ccccc2s1)[N+](=O)[O-].C/C=C\C.CC |
| InChI | InChI=1S/C13H13NO2S.C4H8.C2H6/c1-3-11(14(15)16)9(2)13-8-10-6-4-5-7-12(10)17-13;1-3-4-2;1-2/h3-9H,1-2H3;3-4H,1-2H3;1-2H3/b11-3+;4-3-; |
| InChIKey | OGNRQZZFIXGTGJ-WOSYDIQPSA-N |
| XLogP | 6.79 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene?
The IUPAC name of (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene (CID 144848279) is (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene.
What is the SMILES notation for (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene?
The canonical SMILES for (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene is C/C=C(\C(C)c1cc2ccccc2s1)[N+](=O)[O-].C/C=C\C.CC.
What is the InChIKey of (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene?
The InChIKey is OGNRQZZFIXGTGJ-WOSYDIQPSA-N. The full InChI is InChI=1S/C13H13NO2S.C4H8.C2H6/c1-3-11(14(15)16)9(2)13-8-10-6-4-5-7-12(10)17-13;1-3-4-2;1-2/h3-9H,1-2H3;3-4H,1-2H3;1-2H3/b11-3+;4-3-;.
What are the key properties of (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene?
(Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene has a molecular weight of 333.50 g/mol, XLogP of 6.79, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;ethane;2-[(E)-3-nitropent-3-en-2-yl]-1-benzothiophene is sourced from PubChem (CID 144848279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).