C18H21NO2S — CID 144848332
ethane;3-[(6Z)-2-nitroocta-1,4,6-trien-3-yl]-1-benzothiophene (PubChem CID 144848332) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is ethane;3-[(6Z)-2-nitroocta-1,4,6-trien-3-yl]-1-benzothiophene.
| Compound Name | ethane;3-[(6Z)-2-nitroocta-1,4,6-trien-3-yl]-1-benzothiophene |
|---|---|
| PubChem CID | 144848332 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | ethane;3-[(6Z)-2-nitroocta-1,4,6-trien-3-yl]-1-benzothiophene |
| SMILES | C=C(C(C=C/C=C\C)c1csc2ccccc12)[N+](=O)[O-].CC |
| InChI | InChI=1S/C16H15NO2S.C2H6/c1-3-4-5-8-13(12(2)17(18)19)15-11-20-16-10-7-6-9-14(15)16;1-2/h3-11,13H,2H2,1H3;1-2H3/b4-3-,8-5?; |
| InChIKey | ZNSRWAKWLCXXQK-ZSYOZGKFSA-N |
| XLogP | 5.93 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|