C11H6N4S — CID 144848494
10-thia-3,5,8,13-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11(16),12,14-heptaene (PubChem CID 144848494) has the molecular formula C11H6N4S and a molecular weight of 226.26 g/mol. Its IUPAC name is 10-thia-3,5,8,13-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11(16),12,14-heptaene.
| Compound Name | 10-thia-3,5,8,13-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 144848494 |
| Molecular Formula | C11H6N4S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 10-thia-3,5,8,13-tetrazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2,4,6,11(16),12,14-heptaene |
| SMILES | c1cc2c(cn1)sc1[nH]c3cncnc3c12 |
| InChI | InChI=1S/C11H6N4S/c1-2-12-4-8-6(1)9-10-7(3-13-5-14-10)15-11(9)16-8/h1-5,15H |
| InChIKey | KWDRRPIWPMPOMW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |