C26H20N4 — CID 144848618
8,8-dimethyl-10-(4-phenylpyrimidin-2-yl)-3,10-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11,13,15-heptaene (PubChem CID 144848618) has the molecular formula C26H20N4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 8,8-dimethyl-10-(4-phenylpyrimidin-2-yl)-3,10-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11,13,15-heptaene.
| Compound Name | 8,8-dimethyl-10-(4-phenylpyrimidin-2-yl)-3,10-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11,13,15-heptaene |
|---|---|
| PubChem CID | 144848618 |
| Molecular Formula | C26H20N4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 8,8-dimethyl-10-(4-phenylpyrimidin-2-yl)-3,10-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11,13,15-heptaene |
| SMILES | CC1(C)c2cccnc2-c2c1n(-c1nccc(-c3ccccc3)n1)c1ccccc21 |
| InChI | InChI=1S/C26H20N4/c1-26(2)19-12-8-15-27-23(19)22-18-11-6-7-13-21(18)30(24(22)26)25-28-16-14-20(29-25)17-9-4-3-5-10-17/h3-16H,1-2H3 |
| InChIKey | UXQVGYOZKGOOTM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |