C18H15FN6O2S2 — CID 144848898
6-[(5-fluoro-3-pyridinyl)oxy]-8-methyl-[1,2,4]triazolo[1,5-a]pyridine;N-(4-sulfanyl-6-sulfanylidene-1H-pyridin-2-yl)formamide (PubChem CID 144848898) has the molecular formula C18H15FN6O2S2 and a molecular weight of 430.49 g/mol. Its IUPAC name is 6-[(5-fluoro-3-pyridinyl)oxy]-8-methyl-[1,2,4]triazolo[1,5-a]pyridine;N-(4-sulfanyl-6-sulfanylidene-1H-pyridin-2-yl)formamide.
| Compound Name | 6-[(5-fluoro-3-pyridinyl)oxy]-8-methyl-[1,2,4]triazolo[1,5-a]pyridine;N-(4-sulfanyl-6-sulfanylidene-1H-pyridin-2-yl)formamide |
|---|---|
| PubChem CID | 144848898 |
| Molecular Formula | C18H15FN6O2S2 |
| Molecular Weight | 430.49 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | 6-[(5-fluoro-3-pyridinyl)oxy]-8-methyl-[1,2,4]triazolo[1,5-a]pyridine;N-(4-sulfanyl-6-sulfanylidene-1H-pyridin-2-yl)formamide |
| SMILES | Cc1cc(Oc2cncc(F)c2)cn2ncnc12.O=CNc1cc(S)cc(=S)[nH]1 |
| InChI | InChI=1S/C12H9FN4O.C6H6N2OS2/c1-8-2-11(6-17-12(8)15-7-16-17)18-10-3-9(13)4-14-5-10;9-3-7-5-1-4(10)2-6(11)8-5/h2-7H,1H3;1-3H,(H3,7,8,9,10,11) |
| InChIKey | QUEBCXPTPDFACM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.49 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|