About 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol
4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol (PubChem CID 14484905) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol.
Molecular Properties
| Compound Name | 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol |
| PubChem CID | 14484905 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol |
| SMILES | Oc1ccc2c(c1CCCOc1ccccc1)CCO2 |
| InChI | InChI=1S/C17H18O3/c18-16-8-9-17-15(10-12-20-17)14(16)7-4-11-19-13-5-2-1-3-6-13/h1-3,5-6,8-9,18H,4,7,10-12H2 |
| InChIKey | ONTDNTABODSLIX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol?
The IUPAC name of 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol (CID 14484905) is 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol.
What is the SMILES notation for 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol?
The canonical SMILES for 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol is Oc1ccc2c(c1CCCOc1ccccc1)CCO2.
What is the InChIKey of 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol?
The InChIKey is ONTDNTABODSLIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3/c18-16-8-9-17-15(10-12-20-17)14(16)7-4-11-19-13-5-2-1-3-6-13/h1-3,5-6,8-9,18H,4,7,10-12H2.
What are the key properties of 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol?
4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol has a molecular weight of 270.33 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol is sourced from PubChem (CID 14484905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).