C17H18O3 — CID 14484905
4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol (PubChem CID 14484905) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol.
| Compound Name | 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol |
|---|---|
| PubChem CID | 14484905 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 4-(3-phenoxypropyl)-2,3-dihydro-1-benzofuran-5-ol |
| SMILES | Oc1ccc2c(c1CCCOc1ccccc1)CCO2 |
| InChI | InChI=1S/C17H18O3/c18-16-8-9-17-15(10-12-20-17)14(16)7-4-11-19-13-5-2-1-3-6-13/h1-3,5-6,8-9,18H,4,7,10-12H2 |
| InChIKey | ONTDNTABODSLIX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|