About 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide
4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 144849123) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
| PubChem CID | 144849123 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | CCn1cc(C(N)=O)c2c(N)ncnc21 |
| InChI | InChI=1S/C9H11N5O/c1-2-14-3-5(8(11)15)6-7(10)12-4-13-9(6)14/h3-4H,2H2,1H3,(H2,11,15)(H2,10,12,13) |
| InChIKey | XVXHMIFWTRETFT-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide?
The IUPAC name of 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide (CID 144849123) is 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide.
What is the SMILES notation for 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide?
The canonical SMILES for 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide is CCn1cc(C(N)=O)c2c(N)ncnc21.
What is the InChIKey of 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide?
The InChIKey is XVXHMIFWTRETFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-2-14-3-5(8(11)15)6-7(10)12-4-13-9(6)14/h3-4H,2H2,1H3,(H2,11,15)(H2,10,12,13).
What are the key properties of 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide?
4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide has a molecular weight of 205.22 g/mol, XLogP of 0.13, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-7-ethylpyrrolo[2,3-d]pyrimidine-5-carboxamide is sourced from PubChem (CID 144849123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).