About (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane
(3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane (PubChem CID 144849124) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane.
Molecular Properties
| Compound Name | (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane |
| PubChem CID | 144849124 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane |
| SMILES | C=C[C@H]1CC(C)(C)C[C@@]2(CO2)C1 |
| InChI | InChI=1S/C11H18O/c1-4-9-5-10(2,3)7-11(6-9)8-12-11/h4,9H,1,5-8H2,2-3H3/t9-,11+/m0/s1 |
| InChIKey | OJAPFCHTUYPQKW-GXSJLCMTSA-N |
| XLogP | 2.77 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane?
The IUPAC name of (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane (CID 144849124) is (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane.
What is the SMILES notation for (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane?
The canonical SMILES for (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane is C=C[C@H]1CC(C)(C)C[C@@]2(CO2)C1.
What is the InChIKey of (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane?
The InChIKey is OJAPFCHTUYPQKW-GXSJLCMTSA-N. The full InChI is InChI=1S/C11H18O/c1-4-9-5-10(2,3)7-11(6-9)8-12-11/h4,9H,1,5-8H2,2-3H3/t9-,11+/m0/s1.
What are the key properties of (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane?
(3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane has a molecular weight of 166.26 g/mol, XLogP of 2.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,7S)-7-ethenyl-5,5-dimethyl-1-oxaspiro[2.5]octane is sourced from PubChem (CID 144849124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).