C16H23NO6S — CID 144849554
2-[2-hydroxy-3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-methyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 144849554) has the molecular formula C16H23NO6S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-[2-hydroxy-3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-methyl-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | 2-[2-hydroxy-3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-methyl-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 144849554 |
| Molecular Formula | C16H23NO6S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[2-hydroxy-3-[2-(2-methoxyethoxy)ethoxy]phenyl]-2-methyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | COCCOCCOc1cccc(C2(C)NC(C(=O)O)CS2)c1O |
| InChI | InChI=1S/C16H23NO6S/c1-16(17-12(10-24-16)15(19)20)11-4-3-5-13(14(11)18)23-9-8-22-7-6-21-2/h3-5,12,17-18H,6-10H2,1-2H3,(H,19,20) |
| InChIKey | KWDUVBNTPFXDDF-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|