About methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate
methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate (PubChem CID 14484960) has the molecular formula C19H20O6
and a molecular weight of 344.36 g/mol. Its IUPAC name is methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate.
Molecular Properties
| Compound Name | methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate |
| PubChem CID | 14484960 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate |
| SMILES | COC(=O)c1cccc(OCCCOc2cc3c(cc2O)CCO3)c1 |
| InChI | InChI=1S/C19H20O6/c1-22-19(21)14-4-2-5-15(10-14)23-7-3-8-24-18-12-17-13(6-9-25-17)11-16(18)20/h2,4-5,10-12,20H,3,6-9H2,1H3 |
| InChIKey | SXUHRMFSFOQGMP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate?
The IUPAC name of methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate (CID 14484960) is methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate.
What is the SMILES notation for methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate?
The canonical SMILES for methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate is COC(=O)c1cccc(OCCCOc2cc3c(cc2O)CCO3)c1.
What is the InChIKey of methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate?
The InChIKey is SXUHRMFSFOQGMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O6/c1-22-19(21)14-4-2-5-15(10-14)23-7-3-8-24-18-12-17-13(6-9-25-17)11-16(18)20/h2,4-5,10-12,20H,3,6-9H2,1H3.
What are the key properties of methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate?
methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate has a molecular weight of 344.36 g/mol, XLogP of 2.96, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-[(5-hydroxy-2,3-dihydro-1-benzofuran-6-yl)oxy]propoxy]benzoate is sourced from PubChem (CID 14484960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).