C29H27NO10 — CID 144849742
[(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-methoxypyridine-3-carboxylate (PubChem CID 144849742) has the molecular formula C29H27NO10 and a molecular weight of 549.53 g/mol. Its IUPAC name is [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-methoxypyridine-3-carboxylate.
| Compound Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 144849742 |
| Molecular Formula | C29H27NO10 |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | [(5R,5aR,8aR,9R)-8-oxo-9-(3,4,5-trimethoxyphenyl)-5a,6,8a,9-tetrahydro-5H-[2]benzofuro[5,6-f][1,3]benzodioxol-5-yl] 2-methoxypyridine-3-carboxylate |
| SMILES | COc1cc([C@@H]2c3cc4c(cc3[C@H](OC(=O)c3cccnc3OC)[C@H]3COC(=O)[C@H]23)OCO4)cc(OC)c1OC |
| InChI | InChI=1S/C29H27NO10/c1-33-21-8-14(9-22(34-2)26(21)35-3)23-16-10-19-20(39-13-38-19)11-17(16)25(18-12-37-29(32)24(18)23)40-28(31)15-6-5-7-30-27(15)36-4/h5-11,18,23-25H,12-13H2,1-4H3/t18-,23+,24-,25-/m0/s1 |
| InChIKey | DMMQWHHWFICRIJ-PVUOONDNSA-N |
| XLogP | 3.68 |
| TPSA | 120.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |