About (3-chloro-4-fluorophenyl)methanamine;methoxymethane
(3-chloro-4-fluorophenyl)methanamine;methoxymethane (PubChem CID 144849872) has the molecular formula C9H13ClFNO
and a molecular weight of 205.66 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)methanamine;methoxymethane.
Molecular Properties
| Compound Name | (3-chloro-4-fluorophenyl)methanamine;methoxymethane |
| PubChem CID | 144849872 |
| Molecular Formula | C9H13ClFNO |
| Molecular Weight | 205.66 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (3-chloro-4-fluorophenyl)methanamine;methoxymethane |
| SMILES | COC.NCc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C7H7ClFN.C2H6O/c8-6-3-5(4-10)1-2-7(6)9;1-3-2/h1-3H,4,10H2;1-2H3 |
| InChIKey | MVAYHSJOTJMCJJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-chloro-4-fluorophenyl)methanamine;methoxymethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chloro-4-fluorophenyl)methanamine;methoxymethane?
The IUPAC name of (3-chloro-4-fluorophenyl)methanamine;methoxymethane (CID 144849872) is (3-chloro-4-fluorophenyl)methanamine;methoxymethane.
What is the SMILES notation for (3-chloro-4-fluorophenyl)methanamine;methoxymethane?
The canonical SMILES for (3-chloro-4-fluorophenyl)methanamine;methoxymethane is COC.NCc1ccc(F)c(Cl)c1.
What is the InChIKey of (3-chloro-4-fluorophenyl)methanamine;methoxymethane?
The InChIKey is MVAYHSJOTJMCJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7ClFN.C2H6O/c8-6-3-5(4-10)1-2-7(6)9;1-3-2/h1-3H,4,10H2;1-2H3.
What are the key properties of (3-chloro-4-fluorophenyl)methanamine;methoxymethane?
(3-chloro-4-fluorophenyl)methanamine;methoxymethane has a molecular weight of 205.66 g/mol, XLogP of 2.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-4-fluorophenyl)methanamine;methoxymethane is sourced from PubChem (CID 144849872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).