About 1-benzyl-4-methylsulfanylbenzene;but-2-yne
1-benzyl-4-methylsulfanylbenzene;but-2-yne (PubChem CID 144850170) has the molecular formula C18H20S
and a molecular weight of 268.43 g/mol. Its IUPAC name is 1-benzyl-4-methylsulfanylbenzene;but-2-yne.
Molecular Properties
| Compound Name | 1-benzyl-4-methylsulfanylbenzene;but-2-yne |
| PubChem CID | 144850170 |
| Molecular Formula | C18H20S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 1-benzyl-4-methylsulfanylbenzene;but-2-yne |
| SMILES | CC#CC.CSc1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C14H14S.C4H6/c1-15-14-9-7-13(8-10-14)11-12-5-3-2-4-6-12;1-3-4-2/h2-10H,11H2,1H3;1-2H3 |
| InChIKey | DUTQGEIUNUHDEF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-4-methylsulfanylbenzene;but-2-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-4-methylsulfanylbenzene;but-2-yne?
The IUPAC name of 1-benzyl-4-methylsulfanylbenzene;but-2-yne (CID 144850170) is 1-benzyl-4-methylsulfanylbenzene;but-2-yne.
What is the SMILES notation for 1-benzyl-4-methylsulfanylbenzene;but-2-yne?
The canonical SMILES for 1-benzyl-4-methylsulfanylbenzene;but-2-yne is CC#CC.CSc1ccc(Cc2ccccc2)cc1.
What is the InChIKey of 1-benzyl-4-methylsulfanylbenzene;but-2-yne?
The InChIKey is DUTQGEIUNUHDEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14S.C4H6/c1-15-14-9-7-13(8-10-14)11-12-5-3-2-4-6-12;1-3-4-2/h2-10H,11H2,1H3;1-2H3.
What are the key properties of 1-benzyl-4-methylsulfanylbenzene;but-2-yne?
1-benzyl-4-methylsulfanylbenzene;but-2-yne has a molecular weight of 268.43 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-4-methylsulfanylbenzene;but-2-yne is sourced from PubChem (CID 144850170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).