C41H76O11S — CID 144851266
4-[3-[(Z)-5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-7-hydroxy-10-(2-methoxyethoxymethoxymethyl)-2,8-dimethyldodec-8-en-2-yl]phenyl]-2,3-bis(methoxymethoxy)butanoic acid;ethane (PubChem CID 144851266) has the molecular formula C41H76O11S and a molecular weight of 777.11 g/mol. Its IUPAC name is 4-[3-[(Z)-5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-7-hydroxy-10-(2-methoxyethoxymethoxymethyl)-2,8-dimethyldodec-8-en-2-yl]phenyl]-2,3-bis(methoxymethoxy)butanoic acid;ethane.
| Compound Name | 4-[3-[(Z)-5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-7-hydroxy-10-(2-methoxyethoxymethoxymethyl)-2,8-dimethyldodec-8-en-2-yl]phenyl]-2,3-bis(methoxymethoxy)butanoic acid;ethane |
|---|---|
| PubChem CID | 144851266 |
| Molecular Formula | C41H76O11S |
| Molecular Weight | 777.11 g/mol |
| Exact Mass | 776.51 |
| IUPAC Name | 4-[3-[(Z)-5-[tert-butyl(dimethyl)-λ4-sulfanyl]oxy-7-hydroxy-10-(2-methoxyethoxymethoxymethyl)-2,8-dimethyldodec-8-en-2-yl]phenyl]-2,3-bis(methoxymethoxy)butanoic acid;ethane |
| SMILES | CC.CCC(/C=C(/C)C(O)CC(CCC(C)(C)c1cccc(CC(OCOC)C(OCOC)C(=O)O)c1)OS(C)(C)C(C)(C)C)COCOCCOC |
| InChI | InChI=1S/C39H70O11S.C2H6/c1-13-30(25-47-28-46-20-19-43-8)21-29(2)34(40)24-33(50-51(11,12)38(3,4)5)17-18-39(6,7)32-16-14-15-31(22-32)23-35(48-26-44-9)36(37(41)42)49-27-45-10;1-2/h14-16,21-22,30,33-36,40H,13,17-20,23-28H2,1-12H3,(H,41,42);1-2H3/b29-21-; |
| InChIKey | LPRHOUVIDBKFSY-BNUIAWPISA-N |
| XLogP | 7.90 |
| TPSA | 131.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.11 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|