About (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol
(2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol (PubChem CID 144851394) has the molecular formula C8H14FNO
and a molecular weight of 159.20 g/mol. Its IUPAC name is (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol.
Molecular Properties
| Compound Name | (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol |
| PubChem CID | 144851394 |
| Molecular Formula | C8H14FNO |
| Molecular Weight | 159.20 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol |
| SMILES | CC/C(F)=C(N)\C(C)=C(/C)O |
| InChI | InChI=1S/C8H14FNO/c1-4-7(9)8(10)5(2)6(3)11/h11H,4,10H2,1-3H3/b6-5+,8-7- |
| InChIKey | MRALBYVMPLCRPV-MDAAKZFYSA-N |
| XLogP | 2.39 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.20 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol?
The IUPAC name of (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol (CID 144851394) is (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol.
What is the SMILES notation for (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol?
The canonical SMILES for (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol is CC/C(F)=C(N)\C(C)=C(/C)O.
What is the InChIKey of (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol?
The InChIKey is MRALBYVMPLCRPV-MDAAKZFYSA-N. The full InChI is InChI=1S/C8H14FNO/c1-4-7(9)8(10)5(2)6(3)11/h11H,4,10H2,1-3H3/b6-5+,8-7-.
What are the key properties of (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol?
(2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol has a molecular weight of 159.20 g/mol, XLogP of 2.39, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-4-amino-5-fluoro-3-methylhepta-2,4-dien-2-ol is sourced from PubChem (CID 144851394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).