C10H9F2NO2 — CID 144851540
5-ethoxy-1,3-difluoro-2-[(E)-2-nitrosoethenyl]benzene (PubChem CID 144851540) has the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. Its IUPAC name is 5-ethoxy-1,3-difluoro-2-[(E)-2-nitrosoethenyl]benzene.
| Compound Name | 5-ethoxy-1,3-difluoro-2-[(E)-2-nitrosoethenyl]benzene |
|---|---|
| PubChem CID | 144851540 |
| Molecular Formula | C10H9F2NO2 |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 5-ethoxy-1,3-difluoro-2-[(E)-2-nitrosoethenyl]benzene |
| SMILES | CCOc1cc(F)c(/C=C/N=O)c(F)c1 |
| InChI | InChI=1S/C10H9F2NO2/c1-2-15-7-5-9(11)8(3-4-13-14)10(12)6-7/h3-6H,2H2,1H3/b4-3+ |
| InChIKey | PYQXENSEMNQKGV-ONEGZZNKSA-N |
| XLogP | 3.10 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |