About (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate
(2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate (PubChem CID 144851597) has the molecular formula C14H18N2O5S
and a molecular weight of 326.37 g/mol. Its IUPAC name is (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate.
Molecular Properties
| Compound Name | (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate |
| PubChem CID | 144851597 |
| Molecular Formula | C14H18N2O5S |
| Molecular Weight | 326.37 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate |
| SMILES | CC(=O)ON1C=CCCC1=O.CC(=O)ON1C=CCCC1=S |
| InChI | InChI=1S/C7H9NO3.C7H9NO2S/c1-6(9)11-8-5-3-2-4-7(8)10;1-6(9)10-8-5-3-2-4-7(8)11/h2*3,5H,2,4H2,1H3 |
| InChIKey | CYVNMCFHUCTFGB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate?
The IUPAC name of (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate (CID 144851597) is (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate.
What is the SMILES notation for (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate?
The canonical SMILES for (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate is CC(=O)ON1C=CCCC1=O.CC(=O)ON1C=CCCC1=S.
What is the InChIKey of (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate?
The InChIKey is CYVNMCFHUCTFGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3.C7H9NO2S/c1-6(9)11-8-5-3-2-4-7(8)10;1-6(9)10-8-5-3-2-4-7(8)11/h2*3,5H,2,4H2,1H3.
What are the key properties of (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate?
(2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate has a molecular weight of 326.37 g/mol, XLogP of 2.00, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-3,4-dihydropyridin-1-yl) acetate;(2-sulfanylidene-3,4-dihydropyridin-1-yl) acetate is sourced from PubChem (CID 144851597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).