C31H38N2O2S — CID 144852310
methanimine;(Z)-2-[1-(2-methoxyethyl)-5-[(4Z)-3-propan-2-ylidenehepta-4,6-dienyl]-3-[(E)-3-thiophen-2-ylprop-1-enyl]indol-2-yl]ethenol (PubChem CID 144852310) has the molecular formula C31H38N2O2S and a molecular weight of 502.72 g/mol. Its IUPAC name is methanimine;(Z)-2-[1-(2-methoxyethyl)-5-[(4Z)-3-propan-2-ylidenehepta-4,6-dienyl]-3-[(E)-3-thiophen-2-ylprop-1-enyl]indol-2-yl]ethenol.
| Compound Name | methanimine;(Z)-2-[1-(2-methoxyethyl)-5-[(4Z)-3-propan-2-ylidenehepta-4,6-dienyl]-3-[(E)-3-thiophen-2-ylprop-1-enyl]indol-2-yl]ethenol |
|---|---|
| PubChem CID | 144852310 |
| Molecular Formula | C31H38N2O2S |
| Molecular Weight | 502.72 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | methanimine;(Z)-2-[1-(2-methoxyethyl)-5-[(4Z)-3-propan-2-ylidenehepta-4,6-dienyl]-3-[(E)-3-thiophen-2-ylprop-1-enyl]indol-2-yl]ethenol |
| SMILES | C=C/C=C\C(CCc1ccc2c(c1)c(/C=C/Cc1cccs1)c(/C=C\O)n2CCOC)=C(C)C.[H]N=C |
| InChI | InChI=1S/C30H35NO2S.CH3N/c1-5-6-9-25(23(2)3)15-13-24-14-16-29-28(22-24)27(12-7-10-26-11-8-21-34-26)30(17-19-32)31(29)18-20-33-4;1-2/h5-9,11-12,14,16-17,19,21-22,32H,1,10,13,15,18,20H2,2-4H3;2H,1H2/b9-6-,12-7+,19-17-; |
| InChIKey | QXWFBBXOPHTBCW-PWPNETGKSA-N |
| XLogP | 8.41 |
| TPSA | 58.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.72 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|