About N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium
N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium (PubChem CID 144852641) has the molecular formula C26H33N2OS+
and a molecular weight of 421.63 g/mol. Its IUPAC name is N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium.
Molecular Properties
| Compound Name | N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium |
| PubChem CID | 144852641 |
| Molecular Formula | C26H33N2OS+ |
| Molecular Weight | 421.63 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium |
| SMILES | O[SH+]c1ccccc1.c1ccc(CCN(Cc2ccccc2)C2CCNCC2)cc1 |
| InChI | InChI=1S/C20H26N2.C6H6OS/c1-3-7-18(8-4-1)13-16-22(20-11-14-21-15-12-20)17-19-9-5-2-6-10-19;7-8-6-4-2-1-3-5-6/h1-10,20-21H,11-17H2;1-5,7H/p+1 |
| InChIKey | RAIVCKGZYOZIOZ-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium?
The IUPAC name of N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium (CID 144852641) is N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium.
What is the SMILES notation for N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium?
The canonical SMILES for N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium is O[SH+]c1ccccc1.c1ccc(CCN(Cc2ccccc2)C2CCNCC2)cc1.
What is the InChIKey of N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium?
The InChIKey is RAIVCKGZYOZIOZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C20H26N2.C6H6OS/c1-3-7-18(8-4-1)13-16-22(20-11-14-21-15-12-20)17-19-9-5-2-6-10-19;7-8-6-4-2-1-3-5-6/h1-10,20-21H,11-17H2;1-5,7H/p+1.
What are the key properties of N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium?
N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium has a molecular weight of 421.63 g/mol, XLogP of 4.82, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-(2-phenylethyl)piperidin-4-amine;hydroxy(phenyl)sulfanium is sourced from PubChem (CID 144852641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).