C17H23BINO3S — CID 144852685
8-[[iodo(methoxy)boranyl]sulfanylmethyl]-2-[(4-methoxyphenyl)methyl]-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 144852685) has the molecular formula C17H23BINO3S and a molecular weight of 459.16 g/mol. Its IUPAC name is 8-[[iodo(methoxy)boranyl]sulfanylmethyl]-2-[(4-methoxyphenyl)methyl]-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | 8-[[iodo(methoxy)boranyl]sulfanylmethyl]-2-[(4-methoxyphenyl)methyl]-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 144852685 |
| Molecular Formula | C17H23BINO3S |
| Molecular Weight | 459.16 g/mol |
| Exact Mass | 459.05 |
| IUPAC Name | 8-[[iodo(methoxy)boranyl]sulfanylmethyl]-2-[(4-methoxyphenyl)methyl]-2,5,6,7-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | COB(I)SCC12CCCN1C(=O)C(Cc1ccc(OC)cc1)C2 |
| InChI | InChI=1S/C17H23BINO3S/c1-22-15-6-4-13(5-7-15)10-14-11-17(12-24-18(19)23-2)8-3-9-20(17)16(14)21/h4-7,14H,3,8-12H2,1-2H3 |
| InChIKey | LGDMTQZLBXZEPO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.16 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|