C16H23FN2O — CID 144852705
4-fluoro-2-(2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethylamino)-5-methylphenol (PubChem CID 144852705) has the molecular formula C16H23FN2O and a molecular weight of 278.37 g/mol. Its IUPAC name is 4-fluoro-2-(2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethylamino)-5-methylphenol.
| Compound Name | 4-fluoro-2-(2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethylamino)-5-methylphenol |
|---|---|
| PubChem CID | 144852705 |
| Molecular Formula | C16H23FN2O |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 4-fluoro-2-(2,3,5,6,7,8-hexahydro-1H-indolizin-8a-ylmethylamino)-5-methylphenol |
| SMILES | Cc1cc(O)c(NCC23CCCCN2CCC3)cc1F |
| InChI | InChI=1S/C16H23FN2O/c1-12-9-15(20)14(10-13(12)17)18-11-16-5-2-3-7-19(16)8-4-6-16/h9-10,18,20H,2-8,11H2,1H3 |
| InChIKey | NIRVMRXWMQCKGD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|