C19H15F2N5O2 — CID 144852837
4-[3-amino-2-(2,4-difluorophenoxy)-4-hydrazinylphenyl]-1,6-dihydropyrrolo[2,3-c]pyridin-7-one (PubChem CID 144852837) has the molecular formula C19H15F2N5O2 and a molecular weight of 383.36 g/mol. Its IUPAC name is 4-[3-amino-2-(2,4-difluorophenoxy)-4-hydrazinylphenyl]-1,6-dihydropyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[3-amino-2-(2,4-difluorophenoxy)-4-hydrazinylphenyl]-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 144852837 |
| Molecular Formula | C19H15F2N5O2 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 4-[3-amino-2-(2,4-difluorophenoxy)-4-hydrazinylphenyl]-1,6-dihydropyrrolo[2,3-c]pyridin-7-one |
| SMILES | NNc1ccc(-c2c[nH]c(=O)c3[nH]ccc23)c(Oc2ccc(F)cc2F)c1N |
| InChI | InChI=1S/C19H15F2N5O2/c20-9-1-4-15(13(21)7-9)28-18-11(2-3-14(26-23)16(18)22)12-8-25-19(27)17-10(12)5-6-24-17/h1-8,24,26H,22-23H2,(H,25,27) |
| InChIKey | HIXCDIQXUYEYEC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 121.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|