About 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane
4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane (PubChem CID 144852925) has the molecular formula C10H21N3
and a molecular weight of 183.30 g/mol. Its IUPAC name is 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane.
Molecular Properties
| Compound Name | 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane |
| PubChem CID | 144852925 |
| Molecular Formula | C10H21N3 |
| Molecular Weight | 183.30 g/mol |
| Exact Mass | 183.17 |
| IUPAC Name | 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane |
| SMILES | C/C=C(\C)n1cnnc1.CC.CC |
| InChI | InChI=1S/C6H9N3.2C2H6/c1-3-6(2)9-4-7-8-5-9;2*1-2/h3-5H,1-2H3;2*1-2H3/b6-3+;; |
| InChIKey | ISSQDUSVYHZZAL-RRHCXGJISA-N |
| XLogP | 3.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane?
The IUPAC name of 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane (CID 144852925) is 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane.
What is the SMILES notation for 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane?
The canonical SMILES for 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane is C/C=C(\C)n1cnnc1.CC.CC.
What is the InChIKey of 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane?
The InChIKey is ISSQDUSVYHZZAL-RRHCXGJISA-N. The full InChI is InChI=1S/C6H9N3.2C2H6/c1-3-6(2)9-4-7-8-5-9;2*1-2/h3-5H,1-2H3;2*1-2H3/b6-3+;;.
What are the key properties of 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane?
4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane has a molecular weight of 183.30 g/mol, XLogP of 3.21, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-but-2-en-2-yl]-1,2,4-triazole;ethane is sourced from PubChem (CID 144852925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).